C23H27F2N5O — CID 42684906
1-[5-amino-3-tert-butyl-1-(2,5-difluorophenyl)pyrazol-4-yl]-3-(3-phenylpropyl)urea (PubChem CID 42684906) has the molecular formula C23H27F2N5O and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-[5-amino-3-tert-butyl-1-(2,5-difluorophenyl)pyrazol-4-yl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[5-amino-3-tert-butyl-1-(2,5-difluorophenyl)pyrazol-4-yl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 42684906 |
| Molecular Formula | C23H27F2N5O |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[5-amino-3-tert-butyl-1-(2,5-difluorophenyl)pyrazol-4-yl]-3-(3-phenylpropyl)urea |
| SMILES | CC(C)(C)c1nn(-c2cc(F)ccc2F)c(N)c1NC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C23H27F2N5O/c1-23(2,3)20-19(21(26)30(29-20)18-14-16(24)11-12-17(18)25)28-22(31)27-13-7-10-15-8-5-4-6-9-15/h4-6,8-9,11-12,14H,7,10,13,26H2,1-3H3,(H2,27,28,31) |
| InChIKey | IYUBSPHHIPNTLD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|