C21H24F2N6O — CID 42873167
1-[5-amino-1-(2,5-difluorophenyl)-3-phenylpyrazol-4-yl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 42873167) has the molecular formula C21H24F2N6O and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[5-amino-1-(2,5-difluorophenyl)-3-phenylpyrazol-4-yl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[5-amino-1-(2,5-difluorophenyl)-3-phenylpyrazol-4-yl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 42873167 |
| Molecular Formula | C21H24F2N6O |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-[5-amino-1-(2,5-difluorophenyl)-3-phenylpyrazol-4-yl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1c(-c2ccccc2)nn(-c2cc(F)ccc2F)c1N |
| InChI | InChI=1S/C21H24F2N6O/c1-28(2)12-6-11-25-21(30)26-19-18(14-7-4-3-5-8-14)27-29(20(19)24)17-13-15(22)9-10-16(17)23/h3-5,7-10,13H,6,11-12,24H2,1-2H3,(H2,25,26,30) |
| InChIKey | LMNKPGKMLOXGST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|