C27H21F3N2O3 — CID 4269042
3-(2-oxochromen-3-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 4269042) has the molecular formula C27H21F3N2O3 and a molecular weight of 478.47 g/mol. Its IUPAC name is 3-(2-oxochromen-3-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-oxochromen-3-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4269042 |
| Molecular Formula | C27H21F3N2O3 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 3-(2-oxochromen-3-yl)-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C27H21F3N2O3/c28-27(29,30)20-10-11-23(32-12-3-4-13-32)22(16-20)31-25(33)19-8-5-7-17(14-19)21-15-18-6-1-2-9-24(18)35-26(21)34/h1-2,5-11,14-16H,3-4,12-13H2,(H,31,33) |
| InChIKey | GTDBBHPYECOOGD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|