C22H38ClN3O3S — CID 42700254
3-[butyl-(4-chlorophenyl)sulfonylamino]-N-[5-(diethylamino)pentan-2-yl]propanamide (PubChem CID 42700254) has the molecular formula C22H38ClN3O3S and a molecular weight of 460.08 g/mol. Its IUPAC name is 3-[butyl-(4-chlorophenyl)sulfonylamino]-N-[5-(diethylamino)pentan-2-yl]propanamide.
| Compound Name | 3-[butyl-(4-chlorophenyl)sulfonylamino]-N-[5-(diethylamino)pentan-2-yl]propanamide |
|---|---|
| PubChem CID | 42700254 |
| Molecular Formula | C22H38ClN3O3S |
| Molecular Weight | 460.08 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3-[butyl-(4-chlorophenyl)sulfonylamino]-N-[5-(diethylamino)pentan-2-yl]propanamide |
| SMILES | CCCCN(CCC(=O)NC(C)CCCN(CC)CC)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H38ClN3O3S/c1-5-8-17-26(30(28,29)21-13-11-20(23)12-14-21)18-15-22(27)24-19(4)10-9-16-25(6-2)7-3/h11-14,19H,5-10,15-18H2,1-4H3,(H,24,27) |
| InChIKey | QUXIWTAPEFJZOF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |