C26H37ClN4O5S — CID 42699689
3-[(4-chloro-3-nitrophenyl)sulfonyl-(2-phenylethyl)amino]-N-[5-(diethylamino)pentan-2-yl]propanamide (PubChem CID 42699689) has the molecular formula C26H37ClN4O5S and a molecular weight of 553.13 g/mol. Its IUPAC name is 3-[(4-chloro-3-nitrophenyl)sulfonyl-(2-phenylethyl)amino]-N-[5-(diethylamino)pentan-2-yl]propanamide.
| Compound Name | 3-[(4-chloro-3-nitrophenyl)sulfonyl-(2-phenylethyl)amino]-N-[5-(diethylamino)pentan-2-yl]propanamide |
|---|---|
| PubChem CID | 42699689 |
| Molecular Formula | C26H37ClN4O5S |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 3-[(4-chloro-3-nitrophenyl)sulfonyl-(2-phenylethyl)amino]-N-[5-(diethylamino)pentan-2-yl]propanamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CCN(CCc1ccccc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H37ClN4O5S/c1-4-29(5-2)17-9-10-21(3)28-26(32)16-19-30(18-15-22-11-7-6-8-12-22)37(35,36)23-13-14-24(27)25(20-23)31(33)34/h6-8,11-14,20-21H,4-5,9-10,15-19H2,1-3H3,(H,28,32) |
| InChIKey | IRJRDDRHNCLTBA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|