C24H35ClN4O4S — CID 42724122
2-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-ethylethanamine (PubChem CID 42724122) has the molecular formula C24H35ClN4O4S and a molecular weight of 511.09 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-ethylethanamine.
| Compound Name | 2-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 42724122 |
| Molecular Formula | C24H35ClN4O4S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-[4-(4-chloro-3-nitrophenyl)sulfonylpiperazin-1-yl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-N-ethylethanamine |
| SMILES | CCN(CCN1CCN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C24H35ClN4O4S/c1-4-26(17-18-5-6-19-15-21(18)24(19,2)3)9-10-27-11-13-28(14-12-27)34(32,33)20-7-8-22(25)23(16-20)29(30)31/h5,7-8,16,19,21H,4,6,9-15,17H2,1-3H3 |
| InChIKey | XSTGESUZFQZGHW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|