C21H28N2O3 — CID 42724673
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-methyl-N-(3-methylbutan-2-yl)-3-nitrobenzamide (PubChem CID 42724673) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-methyl-N-(3-methylbutan-2-yl)-3-nitrobenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-methyl-N-(3-methylbutan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 42724673 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-methyl-N-(3-methylbutan-2-yl)-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)N(CC2CC3C=CC2C3)C(C)C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N2O3/c1-13(2)15(4)22(12-19-10-16-6-8-17(19)9-16)21(24)18-7-5-14(3)20(11-18)23(25)26/h5-8,11,13,15-17,19H,9-10,12H2,1-4H3 |
| InChIKey | UKKYOCJVVZIKBW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|