C8H16N4 — CID 4272574
5-hexyl-1H-1,2,4-triazol-3-amine (PubChem CID 4272574) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-hexyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-hexyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 4272574 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 5-hexyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C8H16N4/c1-2-3-4-5-6-7-10-8(9)12-11-7/h2-6H2,1H3,(H3,9,10,11,12) |
| InChIKey | XGXOJXOGWHWNIS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|