C30H39N3O4 — CID 42728572
3-cyclopentyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)propanamide (PubChem CID 42728572) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 3-cyclopentyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-cyclopentyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 42728572 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 3-cyclopentyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)propanamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccccc1OC)N(CCCOC)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C30H39N3O4/c1-4-25(32(20-11-21-36-2)28(34)19-18-22-12-5-6-13-22)29-31-24-15-8-7-14-23(24)30(35)33(29)26-16-9-10-17-27(26)37-3/h7-10,14-17,22,25H,4-6,11-13,18-21H2,1-3H3 |
| InChIKey | UJPCENFNDBUSBX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|