C20H23ClN4OS — CID 42764716
2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide (PubChem CID 42764716) has the molecular formula C20H23ClN4OS and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 42764716 |
| Molecular Formula | C20H23ClN4OS |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[4-[bis(prop-2-enyl)amino]-6-chloropyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)acetamide |
| SMILES | C=CCN(CC=C)c1cc(Cl)nc(SCC(=O)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C20H23ClN4OS/c1-5-9-25(10-6-2)18-12-17(21)23-20(24-18)27-13-19(26)22-16-8-7-14(3)15(4)11-16/h5-8,11-12H,1-2,9-10,13H2,3-4H3,(H,22,26) |
| InChIKey | GFALDSPAWAIIDL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|