C18H18N4O3S2 — CID 42768537
N-(5-methyl-1,3-thiazol-2-yl)-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]acetamide (PubChem CID 42768537) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]acetamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 42768537 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[prop-2-enyl(quinolin-8-ylsulfonyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1ncc(C)s1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C18H18N4O3S2/c1-3-10-22(12-16(23)21-18-20-11-13(2)26-18)27(24,25)15-8-4-6-14-7-5-9-19-17(14)15/h3-9,11H,1,10,12H2,2H3,(H,20,21,23) |
| InChIKey | RRYGBWLJPQLOTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|