C21H24FN3O3S — CID 4277694
1-(4-fluorophenyl)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 4277694) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | 1-(4-fluorophenyl)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 4277694 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | O=S(=O)(c1ccc(N2CCCC2)c(/N=C/c2ccc(F)cc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H24FN3O3S/c22-18-5-3-17(4-6-18)16-23-20-15-19(7-8-21(20)24-9-1-2-10-24)29(26,27)25-11-13-28-14-12-25/h3-8,15-16H,1-2,9-14H2/b23-16+ |
| InChIKey | VNEWMVLZESMKKX-XQNSMLJCSA-N |
| XLogP | 3.20 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|