C26H30N2O4S — CID 42777574
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-2-methoxy-N-(3-methoxypropyl)benzamide (PubChem CID 42777574) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-2-methoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-2-methoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42777574 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-2-methoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C26H30N2O4S/c1-31-16-9-15-27(26(30)23-13-6-7-14-24(23)32-2)20-25(29)28(19-22-12-8-17-33-22)18-21-10-4-3-5-11-21/h3-8,10-14,17H,9,15-16,18-20H2,1-2H3 |
| InChIKey | QMMMZIOVIUULJJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|