C24H32N4O — CID 42783718
3-[4-(dimethylamino)phenyl]-N-(3-methylbutyl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 42783718) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-(3-methylbutyl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-(3-methylbutyl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 42783718 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-(3-methylbutyl)-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | Cc1cccn2c(C(CC(=O)NCCC(C)C)c3ccc(N(C)C)cc3)cnc12 |
| InChI | InChI=1S/C24H32N4O/c1-17(2)12-13-25-23(29)15-21(19-8-10-20(11-9-19)27(4)5)22-16-26-24-18(3)7-6-14-28(22)24/h6-11,14,16-17,21H,12-13,15H2,1-5H3,(H,25,29) |
| InChIKey | OSBKUNRSVVWBCH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|