C26H36N5O+ — CID 7306959
(3S)-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-(2-piperidin-1-ium-1-ylethyl)propanamide (PubChem CID 7306959) has the molecular formula C26H36N5O+ and a molecular weight of 434.61 g/mol. Its IUPAC name is (3S)-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-(2-piperidin-1-ium-1-ylethyl)propanamide.
| Compound Name | (3S)-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-(2-piperidin-1-ium-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 7306959 |
| Molecular Formula | C26H36N5O+ |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (3S)-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-N-(2-piperidin-1-ium-1-ylethyl)propanamide |
| SMILES | Cc1cccn2c([C@@H](CC(=O)NCC[NH+]3CCCCC3)c3ccc(N(C)C)cc3)cnc12 |
| InChI | InChI=1S/C26H35N5O/c1-20-8-7-16-31-24(19-28-26(20)31)23(21-9-11-22(12-10-21)29(2)3)18-25(32)27-13-17-30-14-5-4-6-15-30/h7-12,16,19,23H,4-6,13-15,17-18H2,1-3H3,(H,27,32)/p+1/t23-/m0/s1 |
| InChIKey | DYMSWMRHDAPOFD-QHCPKHFHSA-O |
| XLogP | 2.42 |
| TPSA | 54.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|