C29H34N4O3 — CID 5072076
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 5072076) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 5072076 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(dimethylamino)phenyl]-3-(8-methylimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | COc1ccc(CCNC(=O)CC(c2ccc(N(C)C)cc2)c2cnc3c(C)cccn23)cc1OC |
| InChI | InChI=1S/C29H34N4O3/c1-20-7-6-16-33-25(19-31-29(20)33)24(22-9-11-23(12-10-22)32(2)3)18-28(34)30-15-14-21-8-13-26(35-4)27(17-21)36-5/h6-13,16-17,19,24H,14-15,18H2,1-5H3,(H,30,34) |
| InChIKey | GYMMMMFTCUAUNU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|