C25H27N3O3 — CID 42785389
[1-(1,3-benzodioxol-5-yl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 42785389) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42785389 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-2-methyl-5-phenylpyrrol-3-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(-c3ccccc3)n(-c3ccc4c(c3)OCO4)c2C)CC1 |
| InChI | InChI=1S/C25H27N3O3/c1-3-26-11-13-27(14-12-26)25(29)21-16-22(19-7-5-4-6-8-19)28(18(21)2)20-9-10-23-24(15-20)31-17-30-23/h4-10,15-16H,3,11-14,17H2,1-2H3 |
| InChIKey | OFANOLAOIVPWQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|