C25H27FN2O5 — CID 42801018
3'-[(4-fluorophenyl)methyl]-9'-methoxy-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-4,6-dione (PubChem CID 42801018) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is 3'-[(4-fluorophenyl)methyl]-9'-methoxy-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-4,6-dione.
| Compound Name | 3'-[(4-fluorophenyl)methyl]-9'-methoxy-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-4,6-dione |
|---|---|
| PubChem CID | 42801018 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3'-[(4-fluorophenyl)methyl]-9'-methoxy-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-4,6-dione |
| SMILES | COc1ccc2c(c1)N1CCN(Cc3ccc(F)cc3)CC1C1(C2)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C25H27FN2O5/c1-24(2)32-22(29)25(23(30)33-24)13-17-6-9-19(31-3)12-20(17)28-11-10-27(15-21(25)28)14-16-4-7-18(26)8-5-16/h4-9,12,21H,10-11,13-15H2,1-3H3 |
| InChIKey | UVLRZCLEIKIIFS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|