C18H13F2N3O3S2 — CID 42805683
N-[5-[2-(3,4-difluorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 42805683) has the molecular formula C18H13F2N3O3S2 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[5-[2-(3,4-difluorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[5-[2-(3,4-difluorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 42805683 |
| Molecular Formula | C18H13F2N3O3S2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[5-[2-(3,4-difluorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nnc(SCC(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C18H13F2N3O3S2/c1-26-15-5-3-2-4-11(15)16(25)21-17-22-23-18(28-17)27-9-14(24)10-6-7-12(19)13(20)8-10/h2-8H,9H2,1H3,(H,21,22,25) |
| InChIKey | LIVNJEBRDLJOCY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|