C21H20ClFN4O — CID 42809242
N-[2-[(7-chloro-2-cyclopropylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 42809242) has the molecular formula C21H20ClFN4O and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[2-[(7-chloro-2-cyclopropylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[(7-chloro-2-cyclopropylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42809242 |
| Molecular Formula | C21H20ClFN4O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[2-[(7-chloro-2-cyclopropylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NCCNc1nc(C2CC2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H20ClFN4O/c22-15-5-8-17-18(12-15)26-20(14-3-4-14)27-21(17)25-10-9-24-19(28)11-13-1-6-16(23)7-2-13/h1-2,5-8,12,14H,3-4,9-11H2,(H,24,28)(H,25,26,27) |
| InChIKey | ZDRZHGLLUCRGNU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|