C20H19Cl2FN4O — CID 83282788
N-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 83282788) has the molecular formula C20H19Cl2FN4O and a molecular weight of 421.30 g/mol. Its IUPAC name is N-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 83282788 |
| Molecular Formula | C20H19Cl2FN4O |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCc1nc(NCCNC(=O)Cc2ccc(F)cc2)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C20H19Cl2FN4O/c1-2-17-26-19-15(10-13(21)11-16(19)22)20(27-17)25-8-7-24-18(28)9-12-3-5-14(23)6-4-12/h3-6,10-11H,2,7-9H2,1H3,(H,24,28)(H,25,26,27) |
| InChIKey | PJUVYHITMLXGHJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|