C20H21Cl2N5O2 — CID 83282827
1-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-3-(4-methoxyphenyl)urea (PubChem CID 83282827) has the molecular formula C20H21Cl2N5O2 and a molecular weight of 434.33 g/mol. Its IUPAC name is 1-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 83282827 |
| Molecular Formula | C20H21Cl2N5O2 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-[2-[(6,8-dichloro-2-ethylquinazolin-4-yl)amino]ethyl]-3-(4-methoxyphenyl)urea |
| SMILES | CCc1nc(NCCNC(=O)Nc2ccc(OC)cc2)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C20H21Cl2N5O2/c1-3-17-26-18-15(10-12(21)11-16(18)22)19(27-17)23-8-9-24-20(28)25-13-4-6-14(29-2)7-5-13/h4-7,10-11H,3,8-9H2,1-2H3,(H,23,26,27)(H2,24,25,28) |
| InChIKey | BVJYBGHANFOOEY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|