About 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione
7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione (PubChem CID 42811198) has the molecular formula C20H16ClF2N3O4
and a molecular weight of 435.81 g/mol. Its IUPAC name is 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione |
| PubChem CID | 42811198 |
| Molecular Formula | C20H16ClF2N3O4 |
| Molecular Weight | 435.81 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)n(-c2ccc(F)cc2F)c(=O)c2ccc(Cl)cc21)N1CCOCC1 |
| InChI | InChI=1S/C20H16ClF2N3O4/c21-12-1-3-14-17(9-12)25(11-18(27)24-5-7-30-8-6-24)20(29)26(19(14)28)16-4-2-13(22)10-15(16)23/h1-4,9-10H,5-8,11H2 |
| InChIKey | CDJBVYIUVUVZQA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione?
The IUPAC name of 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione (CID 42811198) is 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione.
What is the SMILES notation for 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione?
The canonical SMILES for 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione is O=C(Cn1c(=O)n(-c2ccc(F)cc2F)c(=O)c2ccc(Cl)cc21)N1CCOCC1.
What is the InChIKey of 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione?
The InChIKey is CDJBVYIUVUVZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClF2N3O4/c21-12-1-3-14-17(9-12)25(11-18(27)24-5-7-30-8-6-24)20(29)26(19(14)28)16-4-2-13(22)10-15(16)23/h1-4,9-10H,5-8,11H2.
What are the key properties of 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione?
7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione has a molecular weight of 435.81 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(2,4-difluorophenyl)-1-(2-morpholin-4-yl-2-oxoethyl)quinazoline-2,4-dione is sourced from PubChem (CID 42811198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).