C22H28FN3O — CID 42815503
N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-cyclohexyl-4-fluorobenzamide (PubChem CID 42815503) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-cyclohexyl-4-fluorobenzamide.
| Compound Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-cyclohexyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 42815503 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-cyclohexyl-4-fluorobenzamide |
| SMILES | CN(C)c1ccc(N)cc1CN(C(=O)c1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H28FN3O/c1-25(2)21-13-12-19(24)14-17(21)15-26(20-6-4-3-5-7-20)22(27)16-8-10-18(23)11-9-16/h8-14,20H,3-7,15,24H2,1-2H3 |
| InChIKey | RTMZJEHXLAEWND-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|