About 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea
1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea (PubChem CID 42822588) has the molecular formula C20H20FN3O2
and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea |
| PubChem CID | 42822588 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea |
| SMILES | CC(C)N(Cc1cc(-c2ccc(F)cc2)on1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20FN3O2/c1-14(2)24(20(25)22-17-6-4-3-5-7-17)13-18-12-19(26-23-18)15-8-10-16(21)11-9-15/h3-12,14H,13H2,1-2H3,(H,22,25) |
| InChIKey | JPVUOFDTHXQTIT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea?
The IUPAC name of 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea (CID 42822588) is 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea?
The canonical SMILES for 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea is CC(C)N(Cc1cc(-c2ccc(F)cc2)on1)C(=O)Nc1ccccc1.
What is the InChIKey of 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea?
The InChIKey is JPVUOFDTHXQTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN3O2/c1-14(2)24(20(25)22-17-6-4-3-5-7-17)13-18-12-19(26-23-18)15-8-10-16(21)11-9-15/h3-12,14H,13H2,1-2H3,(H,22,25).
What are the key properties of 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea?
1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea has a molecular weight of 353.40 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-3-phenyl-1-propan-2-ylurea is sourced from PubChem (CID 42822588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).