C25H31N5O3S — CID 42824142
N-ethyl-5-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxamide (PubChem CID 42824142) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-ethyl-5-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxamide.
| Compound Name | N-ethyl-5-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42824142 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-ethyl-5-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(CSc2nc(CC)cc(N3CCN(c4ccc(OC)cc4)CC3)n2)o1 |
| InChI | InChI=1S/C25H31N5O3S/c1-4-18-16-23(30-14-12-29(13-15-30)19-6-8-20(32-3)9-7-19)28-25(27-18)34-17-21-10-11-22(33-21)24(31)26-5-2/h6-11,16H,4-5,12-15,17H2,1-3H3,(H,26,31) |
| InChIKey | RIVMAAUBKQILCZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|