C28H35N5O2S — CID 42824071
N-ethyl-4-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-methylbenzamide (PubChem CID 42824071) has the molecular formula C28H35N5O2S and a molecular weight of 505.69 g/mol. Its IUPAC name is N-ethyl-4-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-methylbenzamide.
| Compound Name | N-ethyl-4-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 42824071 |
| Molecular Formula | C28H35N5O2S |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-ethyl-4-[[4-ethyl-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]-N-methylbenzamide |
| SMILES | CCc1cc(N2CCN(c3ccc(OC)cc3)CC2)nc(SCc2ccc(C(=O)N(C)CC)cc2)n1 |
| InChI | InChI=1S/C28H35N5O2S/c1-5-23-19-26(33-17-15-32(16-18-33)24-11-13-25(35-4)14-12-24)30-28(29-23)36-20-21-7-9-22(10-8-21)27(34)31(3)6-2/h7-14,19H,5-6,15-18,20H2,1-4H3 |
| InChIKey | VBKIWAPBFSCDBO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|