C28H35N5O4S — CID 46146084
N-(2-methoxyethyl)-4-[[4-(methoxymethyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide (PubChem CID 46146084) has the molecular formula C28H35N5O4S and a molecular weight of 537.69 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[4-(methoxymethyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[4-(methoxymethyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 46146084 |
| Molecular Formula | C28H35N5O4S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[4-(methoxymethyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]sulfanylmethyl]benzamide |
| SMILES | COCCNC(=O)c1ccc(CSc2nc(COC)cc(N3CCN(c4ccc(OC)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C28H35N5O4S/c1-35-17-12-29-27(34)22-6-4-21(5-7-22)20-38-28-30-23(19-36-2)18-26(31-28)33-15-13-32(14-16-33)24-8-10-25(37-3)11-9-24/h4-11,18H,12-17,19-20H2,1-3H3,(H,29,34) |
| InChIKey | MGJWXEPSHFARNQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|