C21H30N4O4S — CID 42824514
1-[[2-benzylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propan-2-yl-1-prop-2-enylurea (PubChem CID 42824514) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[[2-benzylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propan-2-yl-1-prop-2-enylurea.
| Compound Name | 1-[[2-benzylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propan-2-yl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 42824514 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[[2-benzylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propan-2-yl-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cnc(S(=O)(=O)Cc2ccccc2)n1CCOC)C(=O)NC(C)C |
| InChI | InChI=1S/C21H30N4O4S/c1-5-11-24(20(26)23-17(2)3)15-19-14-22-21(25(19)12-13-29-4)30(27,28)16-18-9-7-6-8-10-18/h5-10,14,17H,1,11-13,15-16H2,2-4H3,(H,23,26) |
| InChIKey | CWCXYNGUFCZWMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|