C21H30N4O4S — CID 83283057
N-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-N-[2-(dimethylamino)ethyl]-2-methoxyacetamide (PubChem CID 83283057) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-N-[2-(dimethylamino)ethyl]-2-methoxyacetamide.
| Compound Name | N-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-N-[2-(dimethylamino)ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 83283057 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-N-[2-(dimethylamino)ethyl]-2-methoxyacetamide |
| SMILES | C=CCn1c(CN(CCN(C)C)C(=O)COC)cnc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N4O4S/c1-5-11-25-19(15-24(13-12-23(2)3)20(26)16-29-4)14-22-21(25)30(27,28)17-18-9-7-6-8-10-18/h5-10,14H,1,11-13,15-17H2,2-4H3 |
| InChIKey | KIGHUOZRFSYRCY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|