C26H33N5O3S2 — CID 42824552
1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-1-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 42824552) has the molecular formula C26H33N5O3S2 and a molecular weight of 527.72 g/mol. Its IUPAC name is 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-1-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-1-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 42824552 |
| Molecular Formula | C26H33N5O3S2 |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 1-[(2-benzylsulfonyl-3-prop-2-enylimidazol-4-yl)methyl]-1-[2-(dimethylamino)ethyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | C=CCn1c(CN(CCN(C)C)C(=S)Nc2ccc(OC)cc2)cnc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H33N5O3S2/c1-5-15-31-23(18-27-26(31)36(32,33)20-21-9-7-6-8-10-21)19-30(17-16-29(2)3)25(35)28-22-11-13-24(34-4)14-12-22/h5-14,18H,1,15-17,19-20H2,2-4H3,(H,28,35) |
| InChIKey | XKKCXFNEOYZCOW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|