C21H24N2O3S2 — CID 42837496
N-(3-methoxypropyl)-N-[[2-[(2-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]thiophene-2-carboxamide (PubChem CID 42837496) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[[2-[(2-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-(3-methoxypropyl)-N-[[2-[(2-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42837496 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(3-methoxypropyl)-N-[[2-[(2-methylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]thiophene-2-carboxamide |
| SMILES | COCCCN(Cc1csc(COc2ccccc2C)n1)C(=O)c1cccs1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-16-7-3-4-8-18(16)26-14-20-22-17(15-28-20)13-23(10-6-11-25-2)21(24)19-9-5-12-27-19/h3-5,7-9,12,15H,6,10-11,13-14H2,1-2H3 |
| InChIKey | QGMRJMUYETXMAC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|