C28H33N3O2 — CID 42859196
2-[3-[benzyl(tert-butylcarbamoyl)amino]phenyl]-N-[(3-methylphenyl)methyl]acetamide (PubChem CID 42859196) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[3-[benzyl(tert-butylcarbamoyl)amino]phenyl]-N-[(3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[3-[benzyl(tert-butylcarbamoyl)amino]phenyl]-N-[(3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 42859196 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-[3-[benzyl(tert-butylcarbamoyl)amino]phenyl]-N-[(3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cccc(CNC(=O)Cc2cccc(N(Cc3ccccc3)C(=O)NC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C28H33N3O2/c1-21-10-8-14-24(16-21)19-29-26(32)18-23-13-9-15-25(17-23)31(27(33)30-28(2,3)4)20-22-11-6-5-7-12-22/h5-17H,18-20H2,1-4H3,(H,29,32)(H,30,33) |
| InChIKey | QQHHRVVZRPZGSO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |