C25H28F4N4O2S — CID 42862609
N-(4-fluorophenyl)-2-[[4-[4-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]methyl]morpholine-4-carbothioamide (PubChem CID 42862609) has the molecular formula C25H28F4N4O2S and a molecular weight of 524.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[4-[4-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]methyl]morpholine-4-carbothioamide.
| Compound Name | N-(4-fluorophenyl)-2-[[4-[4-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 42862609 |
| Molecular Formula | C25H28F4N4O2S |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[4-[4-(trifluoromethyl)benzoyl]-1,4-diazepan-1-yl]methyl]morpholine-4-carbothioamide |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCCN(CC2CN(C(=S)Nc3ccc(F)cc3)CCO2)CC1 |
| InChI | InChI=1S/C25H28F4N4O2S/c26-20-6-8-21(9-7-20)30-24(36)33-14-15-35-22(17-33)16-31-10-1-11-32(13-12-31)23(34)18-2-4-19(5-3-18)25(27,28)29/h2-9,22H,1,10-17H2,(H,30,36) |
| InChIKey | XBDWTTLQXMRQEA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|