C23H21ClN2O5S — CID 4287162
[2-[[3-ethoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 4287162) has the molecular formula C23H21ClN2O5S and a molecular weight of 472.95 g/mol. Its IUPAC name is [2-[[3-ethoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[[3-ethoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 4287162 |
| Molecular Formula | C23H21ClN2O5S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-[[3-ethoxycarbonyl-5-methyl-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2cccnc2Cl)sc(C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21ClN2O5S/c1-4-30-23(29)19-18(15-9-7-13(2)8-10-15)14(3)32-21(19)26-17(27)12-31-22(28)16-6-5-11-25-20(16)24/h5-11H,4,12H2,1-3H3,(H,26,27) |
| InChIKey | WTXRDQNHOCYJDE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|