C27H25N5O3S — CID 42910619
N-[4-methylsulfanyl-1-oxo-1-[2-(2-pyridin-3-ylquinoline-4-carbonyl)hydrazinyl]butan-2-yl]benzamide (PubChem CID 42910619) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-[2-(2-pyridin-3-ylquinoline-4-carbonyl)hydrazinyl]butan-2-yl]benzamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-[2-(2-pyridin-3-ylquinoline-4-carbonyl)hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 42910619 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-[2-(2-pyridin-3-ylquinoline-4-carbonyl)hydrazinyl]butan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)NNC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C27H25N5O3S/c1-36-15-13-23(30-25(33)18-8-3-2-4-9-18)27(35)32-31-26(34)21-16-24(19-10-7-14-28-17-19)29-22-12-6-5-11-20(21)22/h2-12,14,16-17,23H,13,15H2,1H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | DUIJTWSMVSEUIE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|