C19H22N6O3S3 — CID 42924723
2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione (PubChem CID 42924723) has the molecular formula C19H22N6O3S3 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione.
| Compound Name | 2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
|---|---|
| PubChem CID | 42924723 |
| Molecular Formula | C19H22N6O3S3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(Cn2nc3sc4ccccc4n3c2=S)CC1 |
| InChI | InChI=1S/C19H22N6O3S3/c1-13-17(14(2)28-21-13)31(26,27)23-9-5-8-22(10-11-23)12-24-19(29)25-15-6-3-4-7-16(15)30-18(25)20-24/h3-4,6-7H,5,8-12H2,1-2H3 |
| InChIKey | WYMJTFQLOVPAOU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|