C19H16Cl3N3O3 — CID 42935027
N-(2-chlorophenyl)-2-[[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]acetamide (PubChem CID 42935027) has the molecular formula C19H16Cl3N3O3 and a molecular weight of 440.71 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]acetamide |
|---|---|
| PubChem CID | 42935027 |
| Molecular Formula | C19H16Cl3N3O3 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H16Cl3N3O3/c1-24(10-17(26)23-15-5-3-2-4-13(15)21)16-9-18(27)25(19(16)28)11-6-7-12(20)14(22)8-11/h2-8,16H,9-10H2,1H3,(H,23,26) |
| InChIKey | VVWBDVGHMKVAQH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|