C22H15N3O4 — CID 4294219
2-(2-benzoyl-9-oxo-1,2-diazabicyclo[5.2.0]nona-3,5-dien-8-yl)isoindole-1,3-dione (PubChem CID 4294219) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-(2-benzoyl-9-oxo-1,2-diazabicyclo[5.2.0]nona-3,5-dien-8-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-benzoyl-9-oxo-1,2-diazabicyclo[5.2.0]nona-3,5-dien-8-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 4294219 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-(2-benzoyl-9-oxo-1,2-diazabicyclo[5.2.0]nona-3,5-dien-8-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1C(=O)N2C1C=CC=CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15N3O4/c26-19(14-8-2-1-3-9-14)23-13-7-6-12-17-18(22(29)25(17)23)24-20(27)15-10-4-5-11-16(15)21(24)28/h1-13,17-18H |
| InChIKey | WCGGHQKXFVOBHG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|