C18H20N4O2S2 — CID 42947194
1-(3-ethylphenyl)-5-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 42947194) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-5-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-ethylphenyl)-5-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42947194 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-(3-ethylphenyl)-5-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2CC(=O)N(c3cccc(CC)c3)C2)s1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-3-8-25-18-21-20-17(26-18)19-16(24)13-10-15(23)22(11-13)14-7-5-6-12(4-2)9-14/h3,5-7,9,13H,1,4,8,10-11H2,2H3,(H,19,20,24) |
| InChIKey | BSWZAPNRXLYRCC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|