C14H14F2NO3P — CID 42950570
[(4-fluorophenyl)-[(2-fluorophenyl)methylamino]methyl]phosphonic acid (PubChem CID 42950570) has the molecular formula C14H14F2NO3P and a molecular weight of 313.24 g/mol. Its IUPAC name is [(4-fluorophenyl)-[(2-fluorophenyl)methylamino]methyl]phosphonic acid.
| Compound Name | [(4-fluorophenyl)-[(2-fluorophenyl)methylamino]methyl]phosphonic acid |
|---|---|
| PubChem CID | 42950570 |
| Molecular Formula | C14H14F2NO3P |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [(4-fluorophenyl)-[(2-fluorophenyl)methylamino]methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NCc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14F2NO3P/c15-12-7-5-10(6-8-12)14(21(18,19)20)17-9-11-3-1-2-4-13(11)16/h1-8,14,17H,9H2,(H2,18,19,20) |
| InChIKey | JDKHDWHECVNQOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|