C12H13Cl2N3S2 — CID 42952479
2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 42952479) has the molecular formula C12H13Cl2N3S2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 42952479 |
| Molecular Formula | C12H13Cl2N3S2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(SCC3CC3(Cl)Cl)nc(N)c2c1C |
| InChI | InChI=1S/C12H13Cl2N3S2/c1-5-6(2)19-10-8(5)9(15)16-11(17-10)18-4-7-3-12(7,13)14/h7H,3-4H2,1-2H3,(H2,15,16,17) |
| InChIKey | IXBKREKJXWFBDW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|