C15H11F4NO3S — CID 42962648
N-(2,5-difluorophenyl)-2-(2,5-difluorophenyl)sulfonylpropanamide (PubChem CID 42962648) has the molecular formula C15H11F4NO3S and a molecular weight of 361.32 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-(2,5-difluorophenyl)sulfonylpropanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-(2,5-difluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 42962648 |
| Molecular Formula | C15H11F4NO3S |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-(2,5-difluorophenyl)sulfonylpropanamide |
| SMILES | CC(C(=O)Nc1cc(F)ccc1F)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H11F4NO3S/c1-8(15(21)20-13-6-9(16)2-4-11(13)18)24(22,23)14-7-10(17)3-5-12(14)19/h2-8H,1H3,(H,20,21) |
| InChIKey | KFOJJJDJMRPULI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |