C21H22ClN3O7S — CID 42968121
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate (PubChem CID 42968121) has the molecular formula C21H22ClN3O7S and a molecular weight of 495.94 g/mol. Its IUPAC name is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate.
| Compound Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
|---|---|
| PubChem CID | 42968121 |
| Molecular Formula | C21H22ClN3O7S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)COC(=O)CN2C(=O)C3C4C=CC(C4)C3C2=O)ccc1Cl |
| InChI | InChI=1S/C21H22ClN3O7S/c1-24(2)33(30,31)15-8-13(5-6-14(15)22)23-16(26)10-32-17(27)9-25-20(28)18-11-3-4-12(7-11)19(18)21(25)29/h3-6,8,11-12,18-19H,7,9-10H2,1-2H3,(H,23,26) |
| InChIKey | LRGRPOQNWMUWRB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|