C23H14BrN3O2S2 — CID 4296937
N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 4296937) has the molecular formula C23H14BrN3O2S2 and a molecular weight of 508.42 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4296937 |
| Molecular Formula | C23H14BrN3O2S2 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Br)cc1-c1nc2ccccc2s1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H14BrN3O2S2/c24-14-9-10-16(15(12-14)22-25-17-6-2-4-8-20(17)31-22)26-23(30)27-21(28)19-11-13-5-1-3-7-18(13)29-19/h1-12H,(H2,26,27,28,30) |
| InChIKey | AHGZGPNJIDNSBL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|