C17H21N5O2S2 — CID 42975890
N-(2-cyanoethyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide (PubChem CID 42975890) has the molecular formula C17H21N5O2S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 42975890 |
| Molecular Formula | C17H21N5O2S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide |
| SMILES | COCCNc1nnc(SC(C)C(=O)N(CCC#N)c2ccccc2)s1 |
| InChI | InChI=1S/C17H21N5O2S2/c1-13(25-17-21-20-16(26-17)19-10-12-24-2)15(23)22(11-6-9-18)14-7-4-3-5-8-14/h3-5,7-8,13H,6,10-12H2,1-2H3,(H,19,20) |
| InChIKey | ZHEBEDLVZPOOLQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|