C20H16ClFN4O5S — CID 42985150
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate (PubChem CID 42985150) has the molecular formula C20H16ClFN4O5S and a molecular weight of 478.89 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 42985150 |
| Molecular Formula | C20H16ClFN4O5S |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate |
| SMILES | CSc1ncc(C(=O)OC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16ClFN4O5S/c1-11(18(27)24-16-8-7-14(26(29)30)9-15(16)21)31-19(28)17-10-23-20(32-2)25(17)13-5-3-12(22)4-6-13/h3-11H,1-2H3,(H,24,27) |
| InChIKey | WOKVKMYAZJZOFT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|