C14H21N3O5 — CID 42987354
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(cyclohexanecarbonylamino)acetate (PubChem CID 42987354) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 42987354 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(CNC(=O)C1CCCCC1)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H21N3O5/c18-11(17-7-6-15-14(17)21)9-22-12(19)8-16-13(20)10-4-2-1-3-5-10/h10H,1-9H2,(H,15,21)(H,16,20) |
| InChIKey | VPVJYYFMDAWFNK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |