C24H32N2O5 — CID 42987476
N-[(2,3-dimethoxyphenyl)methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethylpentanamide (PubChem CID 42987476) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethylpentanamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 42987476 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N,4-dimethylpentanamide |
| SMILES | COc1cccc(CN(C)C(=O)C(CC(C)C)N2C(=O)C3CC=CCC3C2=O)c1OC |
| InChI | InChI=1S/C24H32N2O5/c1-15(2)13-19(26-22(27)17-10-6-7-11-18(17)23(26)28)24(29)25(3)14-16-9-8-12-20(30-4)21(16)31-5/h6-9,12,15,17-19H,10-11,13-14H2,1-5H3 |
| InChIKey | UATQFBSLAVYBMT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|