About (6-methyl-3-pyridinyl) 4-pentoxybenzoate
(6-methyl-3-pyridinyl) 4-pentoxybenzoate (PubChem CID 4299217) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) 4-pentoxybenzoate.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) 4-pentoxybenzoate |
| PubChem CID | 4299217 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (6-methyl-3-pyridinyl) 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C)nc2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-3-4-5-12-21-16-10-7-15(8-11-16)18(20)22-17-9-6-14(2)19-13-17/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | JBKOQSGRZUVFNX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-methyl-3-pyridinyl) 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) 4-pentoxybenzoate?
The IUPAC name of (6-methyl-3-pyridinyl) 4-pentoxybenzoate (CID 4299217) is (6-methyl-3-pyridinyl) 4-pentoxybenzoate.
What is the SMILES notation for (6-methyl-3-pyridinyl) 4-pentoxybenzoate?
The canonical SMILES for (6-methyl-3-pyridinyl) 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(C)nc2)cc1.
What is the InChIKey of (6-methyl-3-pyridinyl) 4-pentoxybenzoate?
The InChIKey is JBKOQSGRZUVFNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c1-3-4-5-12-21-16-10-7-15(8-11-16)18(20)22-17-9-6-14(2)19-13-17/h6-11,13H,3-5,12H2,1-2H3.
What are the key properties of (6-methyl-3-pyridinyl) 4-pentoxybenzoate?
(6-methyl-3-pyridinyl) 4-pentoxybenzoate has a molecular weight of 299.37 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) 4-pentoxybenzoate is sourced from PubChem (CID 4299217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).